Introduction：Basic information about CAS 25659-31-8|lead iodate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | lead iodate |
|---|
| CAS Number | 25659-31-8 | Molecular Weight | 557.00500 |
|---|
| Density | 6.5 g/mL at 25ºC(lit.) | Boiling Point | / |
|---|
| Molecular Formula | I2O6Pb | Melting Point | 300ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | lead(2+),diiodate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 6.5 g/mL at 25ºC(lit.) |
|---|
| Melting Point | 300ºC |
|---|
| Molecular Formula | I2O6Pb |
|---|
| Molecular Weight | 557.00500 |
|---|
| Exact Mass | 557.75500 |
|---|
| PSA | 114.40000 |
|---|
| LogP | 0.67780 |
|---|
| Appearance of Characters | white orthorhombic crystals |
|---|
| InChIKey | DRHWBADNSVQEGH-UHFFFAOYSA-L |
|---|
| SMILES | [O-][I+2]([O-])[O-].[O-][I+2]([O-])[O-].[Pb+2] |
|---|
Safety Information
| Hazard Codes | O,T,N |
|---|
| Risk Phrases | R8;R32;R61;R62;R20/22;R50/53 |
|---|
| Safety Phrases | S45-S53-S60-S61 |
|---|
| RIDADR | UN 3087 5.1/PG 3 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Lead diiodate |
| Lead iodate (Pb(IO3)2) |
| Iodicacid (HIO3),lead(2+) salt (8CI,9CI) |
| l^{2}-lead(2+) ion diiodate |
| Lead iodate (6CI,7CI) |
| CTK1A1314 |
| Lead iodate |
| EINECS 247-168-3 |
| MFCD00049505 |
