Introduction：Basic information about CAS 443642-31-7|1-O-Methyl-3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl-α-D-ribofu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-O-Methyl-3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl-α-D-ribofuranoside |
|---|
| CAS Number | 443642-31-7 | Molecular Weight | 496.208 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 582.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H22Cl4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 305.9±30.1 °C |
|---|
Names
| Name | 1-O-Methyl-3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl-α-D-ribofuranoside |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 582.1±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H22Cl4O5 |
|---|
| Molecular Weight | 496.208 |
|---|
| Flash Point | 305.9±30.1 °C |
|---|
| Exact Mass | 494.022125 |
|---|
| PSA | 57.15000 |
|---|
| LogP | 6.82 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | WYPCSQZGBZNWBF-MXEMCNAFSA-N |
|---|
| SMILES | COC1OC(COCc2ccc(Cl)cc2Cl)C(OCc2ccc(Cl)cc2Cl)C1(C)O |
|---|
Synonyms
| α-D-Ribofuranoside, methyl 3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl- |
| Methyl 3,5-bis-O-(2,4-dichlorobenzyl)-2-C-methyl-α-D-ribofuranoside |
| 1-O-Methyl-3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl-alpha-D-ribofuranoside |
| Methyl 3,5-di-O-(2,4-dichlorobenzyl)-2-C-methyl-a-D-ribofuranoside |
| 1-O-Methyl-3,5-bis-O-[(2,4-dichlorophenyl)methyl]-2-C-methyl-a-D-ribofuranoside |
