Introduction：Basic information about CAS 3107-98-0|dimethyl octafluoroadipate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl octafluoroadipate |
|---|
| CAS Number | 3107-98-0 | Molecular Weight | 318.11800 |
|---|
| Density | 1,5 g/cm3 | Boiling Point | 120 °C |
|---|
| Molecular Formula | C8H6F8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120°C/15mm |
|---|
Names
| Name | dimethyl 2,2,3,3,4,4,5,5-octafluorohexanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,5 g/cm3 |
|---|
| Boiling Point | 120 °C |
|---|
| Molecular Formula | C8H6F8O4 |
|---|
| Molecular Weight | 318.11800 |
|---|
| Flash Point | 120°C/15mm |
|---|
| Exact Mass | 318.01400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.87360 |
|---|
| Index of Refraction | 1.3475 |
|---|
| InChIKey | XPXVIIILXUOEQA-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)OC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00042267 |
| Octafluoroadipic Acid Dimethyl Ester |
| Dimethyl Octafluorohexanedioate |
| Perfluoroadipic Acid Dimethyl Ester |
| Dimethyl Perfluoroadipate |
| Dimethyl Octafluoroadipate |
| PC3015T |
| Octafluor-adipinsaeure-dimethylester |
| Dimethyl-octafluor-hexandioat |
| octafluoro-hexanedioic acid dimethyl ester |
| Octafluorohexanedioic Acid Dimethyl Ester |
