Introduction:Basic information about CAS 3382-63-6|4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol |
|---|
| CAS Number | 3382-63-6 | Molecular Weight | 215.223 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 370.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10FNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.1±23.7 °C |
|---|
Names
| Name | 4-[(4-fluoroanilino)methylidene]cyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 370.9±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10FNO |
|---|
| Molecular Weight | 215.223 |
|---|
| Flash Point | 178.1±23.7 °C |
|---|
| Exact Mass | 215.074646 |
|---|
| PSA | 32.59000 |
|---|
| LogP | 2.95 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | VNNJGDYPPLXJFF-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(C=Nc2ccc(F)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2925290090 |
|---|
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-[[(p-Fluorophenyl)imino]methyl]phenol |
| 4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol |
| 4-[[(4-Fluorophenyl)imino]methyl]phenol |
| MFCD00029739 |
| ALPHA-(4-FLUOROPHENYLIMINO)-P-CRESOL |
| Phenol, 4-[(E)-[(4-fluorophenyl)imino]methyl]- |
| 4-[[(4-Fluorophenyl)imino]methyl]-phenol |