Introduction：Basic information about CAS 3900-79-6|p-Toluenesulfonyl acetone hydrazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Toluenesulfonyl acetone hydrazone |
|---|
| CAS Number | 3900-79-6 | Molecular Weight | 226.29500 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 350.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H14N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.5ºC |
|---|
Names
| Name | 4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 350.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H14N2O2S |
|---|
| Molecular Weight | 226.29500 |
|---|
| Flash Point | 165.5ºC |
|---|
| Exact Mass | 226.07800 |
|---|
| PSA | 66.91000 |
|---|
| LogP | 3.14080 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | XJXJLURHJAVZJI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=NNS(=O)(=O)c1ccc(C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| Acetone p-tosylhydrazone |
| Acetone tolylsulfonylhydrazone |
| Toluenesulfonic acid isopropylidenehydrazide |
| Toluol-4-sulfonsaeure-isopropylidenhydrazid |
| Benzenesulfonic acid,(1-methylethylidene)hydrazide |
| p-Toluenesulfonic acid,isopropylidenehydrazide |
| 4-methyl-N'-(propan-2-ylidene)benzenesulfonohydrazide |
| toluene-4-sulfonic acid isopropylidenehydrazide |
| propan-2-one (toluene-4-sulfonyl)-hydrazone |
| Acetone tosylhydrazone |
| p-Toluenesulfonyl acetone hydrazone |
