Introduction：Basic information about CAS 7146-68-1|p-(p-Chlorophenylsulfonyl)aniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-(p-Chlorophenylsulfonyl)aniline |
|---|
| CAS Number | 7146-68-1 | Molecular Weight | 267.731 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 466.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.9±24.6 °C |
|---|
Names
| Name | 4-((4-Chlorophenyl)sulfonyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 466.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO2S |
|---|
| Molecular Weight | 267.731 |
|---|
| Flash Point | 235.9±24.6 °C |
|---|
| Exact Mass | 267.012085 |
|---|
| PSA | 68.54000 |
|---|
| LogP | 2.57 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | RWIUBJDOESNTFZ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
|---|
Synonyms
| 4-(4-chlorophenyl)sulfonylaniline |
| 4-[(4-Chlorophenyl)sulfonyl]aniline |
| Benzenamine, 4-[(4-chlorophenyl)sulfonyl]- |
| p-(p-Chlorophenylsulfonyl)aniline |
