Introduction:Basic information about CAS 1694-06-0|P-Tolylsulfonglurea, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | P-Tolylsulfonglurea |
|---|
| CAS Number | 1694-06-0 | Molecular Weight | 214.242 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H10N2O3S | Melting Point | 196-198 °C |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | N-Carbamoyl-4-methylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Melting Point | 196-198 °C |
|---|
| Molecular Formula | C8H10N2O3S |
|---|
| Molecular Weight | 214.242 |
|---|
| Exact Mass | 214.041214 |
|---|
| PSA | 97.64000 |
|---|
| LogP | 0.74 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | RUTYWCZSEBLPAK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NC(N)=O)cc1 |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S45-S36/37/39-S26 |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| EINECS 216-900-3 |
| p-Toluenesulfonylurea |
| (4-methylphenyl)sulfonylurea |
| N-Carbamoyl-4-methylbenzenesulfonamide |
| P-Tolylsulfonglurea |
| MFCD00196522 |
| N-(p-Toluenesulfonyl)urea |
| Benzenesulfonamide, N-(aminocarbonyl)-4-methyl- |