Introduction:Basic information about CAS 312623-83-9|disodium,(E)-but-2-enedioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | disodium,(E)-but-2-enedioate |
|---|
| CAS Number | 312623-83-9 | Molecular Weight | 162.02100 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C4H2Na2O4 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | disodium,(E)-but-2-enedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C4H2Na2O4 |
|---|
| Molecular Weight | 162.02100 |
|---|
| Exact Mass | 161.98200 |
|---|
| PSA | 80.26000 |
|---|
| InChIKey | MSJMDZAOKORVFC-CRQBDLPISA-L |
|---|
| SMILES | O=C([O-])C=CC(=O)[O-].[Na+].[Na+] |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Sodium fumarate-2,3-13C2 |
| MFCD01075569 |
| Fumaric acid-2,3-13C2 disodium salt |