Introduction：Basic information about CAS 162401-60-7|Benzoic acid, 3,4-bis(difluoromethoxy)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid, 3,4-bis(difluoromethoxy)- |
|---|
| CAS Number | 162401-60-7 | Molecular Weight | 254.135 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 293.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131.2±25.9 °C |
|---|
Names
| Name | 3,4-Bis(difluoromethoxy)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 293.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6F4O4 |
|---|
| Molecular Weight | 254.135 |
|---|
| Flash Point | 131.2±25.9 °C |
|---|
| Exact Mass | 254.020218 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.458 |
|---|
| InChIKey | UPVZJUHNXCOOHH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(OC(F)F)c(OC(F)F)c1 |
|---|
Synonyms
| 3,4-bis-decyloxy-benzoic acid |
| Benzoic acid, 3,4-bis(difluoromethoxy)- |
| 3,4-di-n-decyloxybenzoic acid |
| 3,4-Didecyloxybenzoic acid |
| 3,4-bis-difluoromethoxy-benzoic acid |
| 3,4-Bis(difluoromethoxy)benzoic acid |
