Introduction:Basic information about CAS 16331-96-7|1' 3'-DIHYDRO-5'-METHOXY-1' 3' 3'-TRI-M&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1' 3'-DIHYDRO-5'-METHOXY-1' 3' 3'-TRI-M& |
|---|
| CAS Number | 16331-96-7 | Molecular Weight | 352.38400 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 527.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H20N2O4 | Melting Point | 134-136ºC(lit.) |
|---|
| MSDS | / | Flash Point | 272.7ºC |
|---|
Names
| Name | 5'-methoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 527.3ºC at 760mmHg |
|---|
| Melting Point | 134-136ºC(lit.) |
|---|
| Molecular Formula | C20H20N2O4 |
|---|
| Molecular Weight | 352.38400 |
|---|
| Flash Point | 272.7ºC |
|---|
| Exact Mass | 352.14200 |
|---|
| PSA | 67.52000 |
|---|
| LogP | 4.72110 |
|---|
| Vapour Pressure | 3.31E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | YPVXHRMUYMHMIT-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Cc3cc([N+](=O)[O-])ccc3O1)N2C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| 5'-methoxy-1',3',3'-trimethyl-6-nitrospiro(2H-1-benzopyran-2,2'-indoline) |
| 1,3,3-Trimethyl-5-methoxy-6'-nitrospiro(indoline-2,2'-2'H-chromene) |
| U-2,3,4-Trichlorophenol |
| 5'-methoxy-1',3',3'-trimethyl-6-nitro-1',3'-dihydro-spiro[chromene-2,2'-indole] |
| MFCD00274627 |
| 1',3',3'-trimethyl-5'-methoxy-6-nitrospiro[2H-1-benzopyran-2,2'-3H-indole] |
| 1',3'-dihydro-5'-methoxy-1',3',3'-trimethyl-6-nitrospiro(2H-1-benzopyran-2,2'-[2H]indole) |