Introduction：Basic information about CAS 618-86-0|1-Chloro-3,5-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Chloro-3,5-dinitrobenzene |
|---|
| CAS Number | 618-86-0 | Molecular Weight | 202.552 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 285.4±20.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3ClN2O4 | Melting Point | 176ºC |
|---|
| MSDS | / | Flash Point | 126.4±21.8 °C |
|---|
Names
| Name | 1-Chloro-3,5-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 285.4±20.0 °C at 760 mmHg |
|---|
| Melting Point | 176ºC |
|---|
| Molecular Formula | C6H3ClN2O4 |
|---|
| Molecular Weight | 202.552 |
|---|
| Flash Point | 126.4±21.8 °C |
|---|
| Exact Mass | 201.978134 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 2.40 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | GFJKASVFAWFUNI-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)cc([N+](=O)[O-])c1 |
|---|
Synonyms
| 4-Chlor-2,6-dinitro-anisol |
| 2.6-Dinitro-4-chloranisol |
| 1-Chloro-3,5-dinitrobenzene |
| 1-chloro-3,5-nitrobenzol |
| 1-Chlor-3,5-dinitro-benzol |
| 4-chloro-2,6-dinitrobenzene |
| 2,6-dinitro-4-chloroanisole |
| Benzene, 1-chloro-3,5-dinitro- |
| 3,5-dinitrochlorobenzene |
| 1-chloro-3,5-dinitro-benzene |
| 5-chloro-1,3-dinitrobenzene |
| 4-Chlor-2.6-dinitro-1-methoxy-benzol |
| 4-chloro-2,6-dinitro-anisole |
