Introduction:Basic information about CAS 13738-63-1|Fluoronitrofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fluoronitrofen |
|---|
| CAS Number | 13738-63-1 | Molecular Weight | 302.08500 |
|---|
| Density | 1.51g/cm3 | Boiling Point | 333.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H6Cl2FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 155.6ºC |
|---|
Names
| Name | fluoronitrofen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.51g/cm3 |
|---|
| Boiling Point | 333.7ºC at 760mmHg |
|---|
| Molecular Formula | C12H6Cl2FNO3 |
|---|
| Molecular Weight | 302.08500 |
|---|
| Flash Point | 155.6ºC |
|---|
| Exact Mass | 300.97100 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 5.35620 |
|---|
| Vapour Pressure | 0.00026mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | MVHWKYHDYCGNQN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Oc2c(F)cc(Cl)cc2Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene,1,5-dichloro-3-fluoro-2-(4-nitrophenoxy) |
| MO-500 |
| CFNP |
| 2,4-Dichloro-6-fluorophenyl p-nitrophenyl ether |
| Fluoronitrofen |
| 2,4-dichloro-6-fluoro-4'-nitrodiphenyl ether |
| Ether,2,4-dichloro-6-fluorophenyl p-nitrophenyl |
| 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene |
| 2,4-Dichloro-6-fluorophenyl-4'-nitrophenyl ether |
| Fluoronitrofen [ISO] |
| 2,4-dichloro-6-fluorophenyl 4-nitrophenyl ether |