Introduction：Basic information about CAS 4465-58-1|1-[(2-hydroxyethyl)amino]anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[(2-hydroxyethyl)amino]anthraquinone |
|---|
| CAS Number | 4465-58-1 | Molecular Weight | 267.27900 |
|---|
| Density | 1.388 g/cm3 | Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276.8ºC |
|---|
Names
| Name | 1-(2-hydroxyethylamino)anthracene-9,10-dione |
|---|
Chemical & Physical Properties
| Density | 1.388 g/cm3 |
|---|
| Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NO3 |
|---|
| Molecular Weight | 267.27900 |
|---|
| Flash Point | 276.8ºC |
|---|
| Exact Mass | 267.09000 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.93920 |
|---|
| Index of Refraction | 1.7 |
|---|
| InChIKey | DQIHOZJLTDMMSG-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCO)cccc21 |
|---|
