Introduction:Basic information about CAS 39604-66-5|4' 6'-DIMETHOXY-2'-HYDROXY-2-PHENYLACET&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4' 6'-DIMETHOXY-2'-HYDROXY-2-PHENYLACET& |
|---|
| CAS Number | 39604-66-5 | Molecular Weight | 272.29600 |
|---|
| Density | 1.193g/cm3 | Boiling Point | 461.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O4 | Melting Point | 114-118ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 171.8ºC |
|---|
| Symbol | GHS05, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-2-phenylethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.193g/cm3 |
|---|
| Boiling Point | 461.4ºC at 760 mmHg |
|---|
| Melting Point | 114-118ºC(lit.) |
|---|
| Molecular Formula | C16H16O4 |
|---|
| Molecular Weight | 272.29600 |
|---|
| Flash Point | 171.8ºC |
|---|
| Exact Mass | 272.10500 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.83480 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | NIWDJRBUBVCKAV-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(O)c(C(=O)Cc2ccccc2)c(OC)c1 |
|---|
Safety Information
| Symbol | GHS05, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318-H400 |
|---|
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi,N |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| HS Code | 2914509090 |
|---|
Customs
| HS Code | 2914509090 |
|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-hydroxy-4,6-dimethoxyphenyl benzyl ketone |
| 4,6-dimethoxy-2-hydroxyphenyl benzyl ketone |
| 2-hydroxy-4,6-dimethoxy-deoxybenzoin |
| MFCD00218596 |
| 2-Hydroxy-4,6-dimethoxy-desoxybenzoin |
| 2'-hydroxy-4',6-dimethoxy-2-phenylacetophenone |
| benzyl 2-hydroxy-4,6-dimethoxyphenyl ketone |