Introduction：Basic information about CAS 2552-45-6|Benzoic acid,4-chloro-3,5-dinitro-, methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,4-chloro-3,5-dinitro-, methyl ester |
|---|
| CAS Number | 2552-45-6 | Molecular Weight | 260.58800 |
|---|
| Density | 1.599g/cm3 | Boiling Point | 381.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H5ClN2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.5ºC |
|---|
Names
| Name | methyl 4-chloro-3,5-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.599g/cm3 |
|---|
| Boiling Point | 381.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H5ClN2O6 |
|---|
| Molecular Weight | 260.58800 |
|---|
| Flash Point | 184.5ºC |
|---|
| Exact Mass | 259.98400 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 2.98940 |
|---|
| Vapour Pressure | 5.09E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | YJUFTUQWRBJBJN-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
|---|
Synonyms
| Benzoic acid,4-chloro-3,5-dinitro-,methyl ester |
| methyl 4-chloro-3,5-dinitro benzoate |
| 4-chloro-3,5-dinitrobenzoic acid methyl ester |
| 4-Chlor-3,5-dinitro-benzoesaeure-methylester |
