Introduction:Basic information about CAS 16966-07-7|Z-Thr(tBu)-OH·DCHA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Thr(tBu)-OH·DCHA |
|---|
| CAS Number | 16966-07-7 | Molecular Weight | 490.675 |
|---|
| Density | / | Boiling Point | 245.5ºC |
|---|
| Molecular Formula | C28H46N2O5 | Melting Point | 123-143ºC |
|---|
| MSDS | / | Flash Point | 338.6ºC |
|---|
Names
| Name | N-cyclohexylcyclohexanamine,(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 245.5ºC |
|---|
| Melting Point | 123-143ºC |
|---|
| Molecular Formula | C28H46N2O5 |
|---|
| Molecular Weight | 490.675 |
|---|
| Flash Point | 338.6ºC |
|---|
| Exact Mass | 490.340668 |
|---|
| PSA | 96.89000 |
|---|
| LogP | 6.59280 |
|---|
| Appearance of Characters | Solid |
|---|
| Vapour Pressure | 4.58E-17mmHg at 25°C |
|---|
| InChIKey | STGGZKHUOOUVBV-YLAFAASESA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(OC(C)(C)C)C(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | Store at RT. |
|---|
Safety Information
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| N-Z-O-tert-butyl-L-threonine (dicyclohexylammonium) salt |
| L-Threonine, O-(1,1-dimethylethyl)-N-[(phenylmethoxy)carbonyl]-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| Dicyclohexylamine (2S,3R)-2-(((benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoate |
| (L)-(1S,2R)-N-(benzyloxycarbonyl)-O-tert-butylthreonine dicyclohexylamine salt |
| N-[(Benzyloxy)carbonyl]-O-(2-methyl-2-propanyl)-L-threonine - N-cyclohexylcyclohexanamine (1:1) |
| Z-Thr(tBu)-OH (dicyclohexylammonium) salt |
| Z-Thr(tBu)-OH-dicyclohexylamine |
| Cbz-O-tert-butyl-L-threonine dicyclohexylamine |
| O-(1,1-Dimethylethyl)-N-[(phenylmethoxy)carbonyl]-L-theronine |
| Z-Thr(t-Bu)OH dicyclohexylamine salt |
| Z-Thr(But)-OH*DCHA |
| Z-Thr(Tbu)-Oh.Dcha |
| Z-Thr(tBu)-OH·DCHA |