Introduction:Basic information about CAS 13094-50-3|1-(3-Bromopropoxy)-4-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3-Bromopropoxy)-4-nitrobenzene |
|---|
| CAS Number | 13094-50-3 | Molecular Weight | 260.085 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 373.3±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10BrNO3 | Melting Point | 56-58ºC |
|---|
| MSDS | / | Flash Point | 179.6±22.3 °C |
|---|
Names
| Name | 1-(3-bromopropoxy)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 373.3±22.0 °C at 760 mmHg |
|---|
| Melting Point | 56-58ºC |
|---|
| Molecular Formula | C9H10BrNO3 |
|---|
| Molecular Weight | 260.085 |
|---|
| Flash Point | 179.6±22.3 °C |
|---|
| Exact Mass | 258.984406 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.19 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | LIBYGKUWXRBMPA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OCCCBr)cc1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 36/37/39-26-22 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-(3-bromopropoxy)-nitrobenzene |
| 1-(3-Bromopropoxy)-4-nitrobenzene |
| Benzene, 1-(3-bromopropoxy)-4-nitro- |
| 1-bromo-3-(4-nitrophenoxy)propane |
| 3-(4-nitrophenoxy)propyl bromide |
| (3-bromo-propyl)-(4-nitro-phenyl)-ether |
| 1-(3-bromopropyloxy)-4-nitrobenzene |
| 3-Bromopropyl 4-nitrophenyl ether |
| (3-Brom-propyl)-(4-nitro-phenyl)-aether |