Introduction：Basic information about CAS 25551-59-1|4-(2-Nitroanilino)-pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-Nitroanilino)-pyridine |
|---|
| CAS Number | 25551-59-1 | Molecular Weight | 215.20800 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 379.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H9N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.5ºC |
|---|
Names
| Name | N-(2-nitrophenyl)pyridin-4-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 379.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H9N3O2 |
|---|
| Molecular Weight | 215.20800 |
|---|
| Flash Point | 183.5ºC |
|---|
| Exact Mass | 215.06900 |
|---|
| PSA | 70.74000 |
|---|
| LogP | 3.32960 |
|---|
| Vapour Pressure | 5.68E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | VHQUELUASRQSPI-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccncc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-[(2-Nitrophenyl)amino]pyridine |
| 4-(2'-Nitroanilino)-pyridin |
| (2-nitro-phenyl)-pyridin-4-yl-amine |
| N-(2-nitrophenyl)-4-pyridinamine |
| 2-Nitro-N-(4'-pyridyl)aniline |
| 4-(2-Nitroanilino)pyridine |
| 4-(o-Nitroanilino)-pyridin |
| 4-(2-Nitroanilino)-pyridine |
