Introduction：Basic information about CAS 33779-37-2|Salprotoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Salprotoside |
|---|
| CAS Number | 33779-37-2 | Molecular Weight | 490.50000 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 639.3ºC at 760mmHg |
|---|
| Molecular Formula | C25H30O10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.6ºC |
|---|
Names
| Name | [(2R)-2-[(2R,3R,4R)-5-ethoxy-4-hydroxy-3-propoxyoxolan-2-yl]-2-(2-hydroxybenzoyl)oxyethyl] 2-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 639.3ºC at 760mmHg |
|---|
| Molecular Formula | C25H30O10 |
|---|
| Molecular Weight | 490.50000 |
|---|
| Flash Point | 211.6ºC |
|---|
| Exact Mass | 490.18400 |
|---|
| PSA | 140.98000 |
|---|
| LogP | 2.39770 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | VKRBJYIBLRSBNI-KOGKCOTNSA-N |
|---|
| SMILES | CCCOC1C(O)C(OCC)OC1C(COC(=O)c1ccccc1O)OC(=O)c1ccccc1O |
|---|
Synonyms
| Salprotoside |
| Salprotosido |
| Salprotosidum |
| UNII-8523JDI86A |
| 1-O-Ethyl-3-O-propyl-D-glucofuranos-5,6-diyl disalicylat |
