Introduction：Basic information about CAS 133044-44-7|6-Acetyl-1,3-benzothiazol-2(3H)-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Acetyl-1,3-benzothiazol-2(3H)-one |
|---|
| CAS Number | 133044-44-7 | Molecular Weight | 193.222 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H7NO2S | Melting Point | 190-194ºC |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 6-acetyl-3H-1,3-benzothiazol-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Melting Point | 190-194ºC |
|---|
| Molecular Formula | C9H7NO2S |
|---|
| Molecular Weight | 193.222 |
|---|
| Exact Mass | 193.019745 |
|---|
| PSA | 78.17000 |
|---|
| LogP | 1.21 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | UFRAIEFXNRTICG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc2[nH]c(=O)sc2c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2934200090 |
|---|
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2(3H)-Benzothiazolone, 6-acetyl- |
| 6-acetyl-2-benzothiazolinone |
| 6-Acetylbenzo[d]thiazol-2(3H)-one |
| 6-acetyl-3H-benzthiazole-2-one |
| 6-Acetyl-1,3-benzothiazol-2(3H)-one |
| 6-acetylbenzothiazolinone |
| 6-acetyl-2(3H)-benzothiazolone |
| 6-ACETYL-2-BENZOTHIAZOLONE |
| MFCD02660572 |
| 6-Acetylbenzothiazolin-2-one |
