Introduction：Basic information about CAS 13920-98-4|5-(Methylsulfonyl)-1,3-benzoxazol-2(3H)-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(Methylsulfonyl)-1,3-benzoxazol-2(3H)-one |
|---|
| CAS Number | 13920-98-4 | Molecular Weight | 213.210 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H7NO4S | Melting Point | 223-224 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-methylsulfonyl-3H-1,3-benzoxazol-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 223-224 °C |
|---|
| Molecular Formula | C8H7NO4S |
|---|
| Molecular Weight | 213.210 |
|---|
| Exact Mass | 213.009583 |
|---|
| PSA | 88.52000 |
|---|
| LogP | -0.80 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | QUKRTJQSGPLQKQ-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc2oc(=O)[nH]c2c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Benzoxazolinone,5-methylsulfonyl |
| EINECS 237-688-9 |
| 5-(Methylsulfonyl)-1,3-benzoxazol-2(3H)-one |
| 5-methanesulfonyl-3H-benzoxazol-2-one |
| 2(3H)-Benzoxazolone, 5-(methylsulfonyl)- |
| 5-Methylsulfon-benzoxazolon |
| 5-Methansulfonyl-3H-benzoxazol-2-on |
| 5-methanesulfonyl-3H-benzooxazol-2-one |
