Introduction:Basic information about CAS 161356-05-4|4-Hydroxy-N-phenylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Hydroxy-N-phenylbenzenesulfonamide |
|---|
| CAS Number | 161356-05-4 | Molecular Weight | 249.286 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 440.6±47.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3S | Melting Point | 135-137 °C |
|---|
| MSDS | / | Flash Point | 220.3±29.3 °C |
|---|
Names
| Name | 4-hydroxy-N-phenylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 440.6±47.0 °C at 760 mmHg |
|---|
| Melting Point | 135-137 °C |
|---|
| Molecular Formula | C12H11NO3S |
|---|
| Molecular Weight | 249.286 |
|---|
| Flash Point | 220.3±29.3 °C |
|---|
| Exact Mass | 249.045959 |
|---|
| PSA | 74.78000 |
|---|
| LogP | 2.31 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | ZCDVIQXSESHKES-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Nc1ccccc1)c1ccc(O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N-phenyl-4-hydroxybenzenesulfonamide |
| 4-Hydroxy-benzolsulfonsaeure-anilid |
| 4-Hydroxybenzensulfoneanilide |
| 4-Hydroxy-N-phenylbenzene sulphonamide |
| Benzenesulfonamide, 4-hydroxy-N-phenyl- |
| Phenol-sulfonsaeure-(4)-anilid |
| 4-hydroxy-benzenesulfonic acid anilide |
| 4-Hydroxy-N-phenylbenzenesulfonamide |
| N-(Phenyl)-1-phenol-4-sulfonamide |
| p-hydroxy-N-phenylbenzenesulfonamide |