Introduction:Basic information about CAS 25128-35-2|2,3-Dioxoindoline-7-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Dioxoindoline-7-carboxylic acid |
|---|
| CAS Number | 25128-35-2 | Molecular Weight | 191.140 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H5NO4 | Melting Point | 268-275ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,3-dioxo-1H-indole-7-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Melting Point | 268-275ºC |
|---|
| Molecular Formula | C9H5NO4 |
|---|
| Molecular Weight | 191.140 |
|---|
| Exact Mass | 191.021851 |
|---|
| PSA | 83.47000 |
|---|
| LogP | 1.36 |
|---|
| Index of Refraction | 1.660 |
|---|
| InChIKey | ROODQCZSWXEDJL-UHFFFAOYSA-N |
|---|
| SMILES | O=C1Nc2c(C(=O)O)cccc2C1=O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD00612492 |
| 1H-indole-2,3-dione-7-carboxylic acid |
| 2,3-Dioxo-7-indolinecarboxylic acid |
| 2,3-dioxoindoline-7-carboxylic acid |
| Isatin-7-carboxylic acid |
| 1H-Indole-7-carboxylic acid, 2,3-dihydro-2,3-dioxo- |
| 2,3-dioxo-2,3-dihydro-indole-7-carboxylic acid |
| 2,3-dioxo-1H-benzo[d]azolidine-7-carboxylic acid |
| 2,3-dioxo-2,3-dihydro-1H-indole-7-carboxylic acid |
| 2,3-Dioxo-indolin-7-carbonsaeure |