Introduction：Basic information about CAS 31407-27-9|3-Quinolinecarbonitrile,2-amino-6-chloro-4-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Quinolinecarbonitrile,2-amino-6-chloro-4-phenyl- |
|---|
| CAS Number | 31407-27-9 | Molecular Weight | 279.72400 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 518.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H10ClN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 267.2ºC |
|---|
Names
| Name | 2-amino-6-chloro-4-phenylquinoline-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 518.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H10ClN3 |
|---|
| Molecular Weight | 279.72400 |
|---|
| Flash Point | 267.2ºC |
|---|
| Exact Mass | 279.05600 |
|---|
| PSA | 62.70000 |
|---|
| LogP | 4.59028 |
|---|
| Index of Refraction | 1.725 |
|---|
| InChIKey | UBEKCEMXDFJEDN-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c(N)nc2ccc(Cl)cc2c1-c1ccccc1 |
|---|
Synonyms
| 2-amino-3-cyano-4-phenyl-6-chloroquinoline |
| 2-Amino-3-cyan-4-phenyl-6-chlor-chinolin |
| 2-amino-6-chloro-4-phenyl-quinoline-3-carbonitrile |
| HMS543G17 |
| 2-Amino-6-chloro-3-cyano-4-phenylchinolin |
