Introduction：Basic information about CAS 25060-18-8|9,10-Anthracenedione,1,4-dihydroxy-2,3-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Anthracenedione,1,4-dihydroxy-2,3-dimethyl- |
|---|
| CAS Number | 25060-18-8 | Molecular Weight | 268.26400 |
|---|
| Density | 1.423g/cm3 | Boiling Point | 526.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H12O4 | Melting Point | 255-257ºC(lit.) |
|---|
| MSDS | / | Flash Point | 286.5ºC |
|---|
Names
| Name | 1,4-dihydroxy-2,3-dimethylanthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.423g/cm3 |
|---|
| Boiling Point | 526.9ºC at 760mmHg |
|---|
| Melting Point | 255-257ºC(lit.) |
|---|
| Molecular Formula | C16H12O4 |
|---|
| Molecular Weight | 268.26400 |
|---|
| Flash Point | 286.5ºC |
|---|
| Exact Mass | 268.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.49000 |
|---|
| Vapour Pressure | 1.02E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | UEIREGKJDNBMLZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c(O)c2c(c1O)C(=O)c1ccccc1C2=O |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2914690090 |
|---|
Customs
| HS Code | 2914690090 |
|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,3-dimethylquinizarin |
| 9,10-Anthracenedione,1,4-dihydroxy-2,3-dimethyl |
| 1,4-dihydroxy-2,3-dimethylanthraquinone |
| 6,7-dimethyl 1,4-dioxido-9,10-anthraquinone |
| 2,3-DICHLORO-6-NITROBENZYLAMINE |
| 2,3-dimethyl-1,4-dihydroxyanthraquinone |
| 1,4-dihydroxy-2,3-dimethyl-9,10-anthraquinone |
