Introduction：Basic information about CAS 139484-40-5|4-phenacyloxybenzaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-phenacyloxybenzaldehyde |
|---|
| CAS Number | 139484-40-5 | Molecular Weight | 240.25400 |
|---|
| Density | 1.195g/cm3 | Boiling Point | 429ºC at 760mmHg |
|---|
| Molecular Formula | C15H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193ºC |
|---|
Names
| Name | 4-phenacyloxybenzaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.195g/cm3 |
|---|
| Boiling Point | 429ºC at 760mmHg |
|---|
| Molecular Formula | C15H12O3 |
|---|
| Molecular Weight | 240.25400 |
|---|
| Flash Point | 193ºC |
|---|
| Exact Mass | 240.07900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.76080 |
|---|
| Vapour Pressure | 1.45E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | DUFOKNRIMNOESJ-UHFFFAOYSA-N |
|---|
| SMILES | O=Cc1ccc(OCC(=O)c2ccccc2)cc1 |
|---|
Synonyms
| 2-(4-formylphenoxy)-1-phenylethanone |
| 4-(2-oxo-2-phenylethoxy)benzaldehyde |
| Benzaldehyde,4-(2-oxo-2-phenylethoxy) |
