Introduction：Basic information about CAS 134030-21-0|N,N'-Dimesityl-1,2-ethanediamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-Dimesityl-1,2-ethanediamine |
|---|
| CAS Number | 134030-21-0 | Molecular Weight | 296.450 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 471.5±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H28N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 289.4±17.2 °C |
|---|
Names
| Name | N,N'-bis(2,4,6-trimethylphenyl)ethane-1,2-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 471.5±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H28N2 |
|---|
| Molecular Weight | 296.450 |
|---|
| Flash Point | 289.4±17.2 °C |
|---|
| Exact Mass | 296.225250 |
|---|
| PSA | 24.06000 |
|---|
| LogP | 5.54 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | RQXQQXIIAQTDHU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(NCCNc2c(C)cc(C)cc2C)c(C)c1 |
|---|
Safety Information
Customs
| HS Code | 2921290000 |
|---|
| Summary | 2921290000 other acyclic polyamines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| N,N'-Dimesityl-1,2-ethanediamine |
| (2,4,6-Me3C6H2)NHCH2CH2NH(2,4,6-Me3C6H2) |
| N,N'-bis(2,4,6-trimethylphenylamino)ethane |
| N1,N2-Dimesitylethane-1,2-diamine |
| 1,2-Ethanediamine, N,N-bis(2,4,6-trimethylphenyl)- |
| N,N'-bis(mesityl)ethylenediamine |
| 1,2-bis(2,4,6-trimethylphenylamino)ethane |
| N,N'-(2,4,6-trimethylphenyl)ethylenediamine |
| UPCMLD00WV-78 |
