Introduction：Basic information about CAS 31162-13-7|2-Azidobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Azidobenzoic acid |
|---|
| CAS Number | 31162-13-7 | Molecular Weight | 163.13300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H5N3O2 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | -27.4 °F |
|---|
| Symbol |
GHS02, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 2-Azidobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H5N3O2 |
|---|
| Molecular Weight | 163.13300 |
|---|
| Exact Mass | 163.03800 |
|---|
| PSA | 87.05000 |
|---|
| LogP | 1.77936 |
|---|
| InChIKey | JCBWQNLTYXTHBZ-UHFFFAOYSA-N |
|---|
| SMILES | [N-]=[N+]=Nc1ccccc1C(=O)O |
|---|
Safety Information
| Symbol |
GHS02, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H315-H319 |
|---|
| Precautionary Statements | P210-P305 + P351 + P338 |
|---|
| RIDADR | UN 2398 3 / PGII |
|---|
| HS Code | 2929909090 |
|---|
| Flash Point(F) | -27.4 °F |
|---|
| Flash Point(C) | -33 °C |
|---|
Customs
| HS Code | 2929909090 |
|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| o-Azidobenzoic acid solution |
| o-azidobenzoic acid |
| ortho-azidobenzoic acid |
| 2-Azido-benzoesaeure |
| 2-Azido-benzoic acid |
| Benzoic acid,2-azido |
