Introduction：Basic information about CAS 16135-26-5|Methyl 5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylate |
|---|
| CAS Number | 16135-26-5 | Molecular Weight | 218.20900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H10N2O3 |
|---|
| Molecular Weight | 218.20900 |
|---|
| Exact Mass | 218.06900 |
|---|
| PSA | 64.09000 |
|---|
| LogP | 0.95220 |
|---|
| InChIKey | HRMGCUMSMUHWIX-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(=O)n(-c2ccccc2)[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Phenyl-3-carbomethoxypyrazolin-5-on |
| 5-Oxo-1-phenaethyl-pyrrolidin-3-carbonsaeure |
| 5-oxo-1-phenethyl-pyrrolidine-3-carboxylic acid |
| 5-oxo-1-phenyl-2,5-dihydro-1H-pyrazole-3-carboxylic acid methyl ester |
| 2-Phenyl-5-methoxycarbonyl-pyrazolon |
| 1-phenyl-3-methoxycarbonylpyrazol-5-one |
| 5-oxo-1-phenethyl-3-pyrrolidinecarboxylic acid |
| 5-Oxo-1-phenyl-2,5-dihydro-1H-pyrazol-3-carbonsaeure-methylester |
| 3-Carbomethoxy-1-Phenyl-5-Pyrazolinon |
