Introduction:Basic information about CAS 61792-12-9|cinnamyl tiglate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cinnamyl tiglate |
|---|
| CAS Number | 61792-12-9 | Molecular Weight | 216.27600 |
|---|
| Density | 1.03g/cm3 | Boiling Point | 340.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.2ºC |
|---|
Names
| Name | [(E)-3-phenylprop-2-enyl] (E)-2-methylbut-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.03g/cm3 |
|---|
| Boiling Point | 340.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O2 |
|---|
| Molecular Weight | 216.27600 |
|---|
| Flash Point | 198.2ºC |
|---|
| Exact Mass | 216.11500 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.20920 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | KRNURAJANZKGQN-UHFFFAOYSA-N |
|---|
| SMILES | CC=C(C)C(=O)OCC=Cc1ccccc1 |
|---|
Synonyms
| Cinnamyl tiglate |
| EINECS 263-215-0 |
| Cinnamyl 2-methylcrotonate |
| EINECS 282-533-0 |