Introduction:Basic information about CAS 1625-91-8|4,4'-Di-tert-butylbiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Di-tert-butylbiphenyl |
|---|
| CAS Number | 1625-91-8 | Molecular Weight | 266.420 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 337.8±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H26 | Melting Point | 126-130 °C(lit.) |
|---|
| MSDS | / | Flash Point | 173.9±11.7 °C |
|---|
Names
| Name | 4,4'-di-tert-butylbiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 337.8±0.0 °C at 760 mmHg |
|---|
| Melting Point | 126-130 °C(lit.) |
|---|
| Molecular Formula | C20H26 |
|---|
| Molecular Weight | 266.420 |
|---|
| Flash Point | 173.9±11.7 °C |
|---|
| Exact Mass | 266.203461 |
|---|
| LogP | 7.35 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.520 |
|---|
| InChIKey | CDKCEZNPAYWORX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(-c2ccc(C(C)(C)C)cc2)cc1 |
|---|
| Water Solubility | dioxane: 0.1 g/mL, clear |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2902909090 |
|---|
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| 4,4′-Di-tert-butylbiphenyl |
| 4,4‘-Di-tert-butylbiphenyl |
| 4,4'-Di-tert-butylbiphenyl Zone Refined |
| MFCD00008834 |
| 4,4'-Bis(2-methyl-2-propanyl)biphenyl |
| 4,4'-Di-tert-butyl-1,1'-biphenyl |
| 4,4'-di-t-butylbiphenyl |
| 1-tert-butyl-4-(4-tert-butylphenyl)benzene |
| 4,4'-DI-TERT-BUTYLBIPHENYL |
| EINECS 216-615-4 |
| 1,1'-Biphenyl, 4,4'-bis(1,1-dimethylethyl)- |