Introduction：Basic information about CAS 610-53-7|2,4-DINITROACETANILIDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-DINITROACETANILIDE |
|---|
| CAS Number | 610-53-7 | Molecular Weight | 225.15800 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 458.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7N3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 231ºC |
|---|
Names
| Name | 2,4-dinitroacetanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 458.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7N3O5 |
|---|
| Molecular Weight | 225.15800 |
|---|
| Flash Point | 231ºC |
|---|
| Exact Mass | 225.03900 |
|---|
| PSA | 120.74000 |
|---|
| LogP | 2.58080 |
|---|
| Index of Refraction | 1.654 |
|---|
| InChIKey | BRZYMGKDOVQJGX-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2',4'-dinitroacetanilide |
| Acetanilide,2',4'-dinitro |
| P-ACETODINITRAMINE |
| Essigsaeure-(2,4-dinitro-anilid) |
| N-(2,4-dinitrophenyl)acetamide |
| N-acetyl-2,4-dinitroaniline |
| EINECS 210-227-9 |
| n-(2,4-dinitrophenyl)-acetamid |
| N-(2,5-dinitrophenyl)acetamide |
| 2.4-Dinitro-acetanilid |
| N1-(2,4-dinitrophenyl)acetamide |
| acetic acid-(2,4-dinitro-anilide) |
| 1-Acetamido-2,4-dinitrobenzene |
| N-(2,4-dinitrophenyl)ethanamide |
