Introduction：Basic information about CAS 161373-05-3|3-(2-Phenylethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-Phenylethyl)benzoic acid |
|---|
| CAS Number | 161373-05-3 | Molecular Weight | 226.270 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 373.2±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.4±16.7 °C |
|---|
Names
| Name | benzoic acid,3-(2-phenylethyl) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 373.2±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.270 |
|---|
| Flash Point | 174.4±16.7 °C |
|---|
| Exact Mass | 226.099380 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.38 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | JAHAEINDORLHMF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(CCc2ccccc2)c1 |
|---|
Synonyms
| 3-(2-Phenylethyl)-benzoic Acid |
| 5-bromo-2-(4-(trifluoromethyl)phenyl)pyridine |
| 5-bromo-2-{[3-(phenylethyl)benzoyl]amino}benzoic acid |
| 3-(2-Phenylethyl)benzoic acid |
| 3-phenethylbenzoic acid |
| Benzoic acid, 3-(2-phenylethyl)- |
