Introduction：Basic information about CAS 13615-38-8|3-Methyl-1-nitronaphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methyl-1-nitronaphthalene |
|---|
| CAS Number | 13615-38-8 | Molecular Weight | 187.195 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 330.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160.1±12.1 °C |
|---|
Names
| Name | 3-methyl-1-nitronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 330.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO2 |
|---|
| Molecular Weight | 187.195 |
|---|
| Flash Point | 160.1±12.1 °C |
|---|
| Exact Mass | 187.063324 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.64 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | HKMFJWNUOWBRGF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])c2ccccc2c1 |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 3-Methyl-1-nitronaphthalene |
| 3-methyl-1-nitro-naphthalene |
| 2-methyl-4-nitronaphthalene |
| Naphthalene,3-methyl-1-nitro |
| 4-nitro-2-methylnaphthalene |
| Naphthalene, 3-methyl-1-nitro- |
| 3-Methyl-1-nitro-naphthalin |
| 1-Nitro-3-methyl-naphthalin |
