Introduction：Basic information about CAS 132-87-6|Benzoyl J acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoyl J acid |
|---|
| CAS Number | 132-87-6 | Molecular Weight | 343.35400 |
|---|
| Density | 1.535 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H13NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzoyl J acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.535 g/cm3 |
|---|
| Molecular Formula | C17H13NO5S |
|---|
| Molecular Weight | 343.35400 |
|---|
| Exact Mass | 343.05100 |
|---|
| PSA | 112.08000 |
|---|
| LogP | 4.19820 |
|---|
| InChIKey | ZLHGMJOGMLVDFS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 5-Chlor-2-benzamino-benzoesaeure-methylester |
| 7-benzoylamino-4-hydroxy-naphthalene-2-sulfonic acid |
| EINECS 205-080-2 |
| 2-benzoylamino-5-hydroxynaphthalene-7-sulfonic acid |
| 6-benzoylamino-1-naphthol-3-sulphonic acid |
| 7-Benzoylamino-4-hydroxy-naphthalin-2-sulfonsaeure |
| 2-benzoylamino-5-chloro-benzoic acid methyl ester |
| 4-hydroxy-7-benzoylaminonaphthalene-2-sulphonic acid |
