Introduction：Basic information about CAS 441351-32-2|(Z)-PTEROSTILBENE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-PTEROSTILBENE |
|---|
| CAS Number | 441351-32-2 | Molecular Weight | 256.29600 |
|---|
| Density | 1.169 | Boiling Point | 420.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.1ºC |
|---|
Names
| Name | cis-Pterostilbene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.169 |
|---|
| Boiling Point | 420.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O3 |
|---|
| Molecular Weight | 256.29600 |
|---|
| Flash Point | 208.1ºC |
|---|
| Exact Mass | 256.11000 |
|---|
| PSA | 38.69000 |
|---|
| LogP | 3.57980 |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | VLEUZFDZJKSGMX-ARJAWSKDSA-N |
|---|
| SMILES | COc1cc(C=Cc2ccc(O)cc2)cc(OC)c1 |
|---|
Synonyms
| cis-3,5-dimethoxy-4'-hydroxystilbene |
| 3,5-dimethoxy-4'-hydroxystilbene |
| 3-Penten-2-one,4-hydroxy-1,5-dimethoxy |
