Introduction：Basic information about CAS 25186-43-0|N-isopropyl-4-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-isopropyl-4-nitroaniline |
|---|
| CAS Number | 25186-43-0 | Molecular Weight | 180.20400 |
|---|
| Density | 1.169g/cm3 | Boiling Point | 307.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.7ºC |
|---|
Names
| Name | 4-nitro-N-propan-2-ylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.169g/cm3 |
|---|
| Boiling Point | 307.3ºC at 760mmHg |
|---|
| Molecular Formula | C9H12N2O2 |
|---|
| Molecular Weight | 180.20400 |
|---|
| Flash Point | 139.7ºC |
|---|
| Exact Mass | 180.09000 |
|---|
| PSA | 57.85000 |
|---|
| LogP | 3.01130 |
|---|
| Vapour Pressure | 0.000731mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | VTSUWHFLMJLYKN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Nc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-isopropylamino-nitrobenzene |
| N-4-nitrophenylisopropylamino |
| N-Isopropyl-4-nitroaniline |
| N-isopropyl-p-nitroaniline |
| N-<4-Nitro-phenyl>-iso-propylamin |
| N-Isopropyl-4-nitro-anilin |
| EINECS 246-721-6 |
