Introduction：Basic information about CAS 31648-22-3|Methyl 3-amino-4-(4-methoxyphenyl)-2,2-dimethylbutanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 3-amino-4-(4-methoxyphenyl)-2,2-dimethylbutanoate |
|---|
| CAS Number | 31648-22-3 | Molecular Weight | 251.32100 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 361.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.2ºC |
|---|
Names
| Name | Methyl 3-amino-4-(4-methoxyphenyl)-2,2-dimethylbutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 361.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H21NO3 |
|---|
| Molecular Weight | 251.32100 |
|---|
| Flash Point | 134.2ºC |
|---|
| Exact Mass | 251.15200 |
|---|
| PSA | 61.55000 |
|---|
| LogP | 2.46450 |
|---|
| Index of Refraction | 1.511 |
|---|
| InChIKey | KFAQETCQBMUQHT-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(C)(C)C(N)Cc1ccc(OC)cc1 |
|---|
Synonyms
| 3-amino-2,2'-bipyridine |
| bipyridylamide |
