Introduction:Basic information about CAS 130369-05-0|tert-Butyl [3-(hydroxymethyl)cyclobutyl]carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl [3-(hydroxymethyl)cyclobutyl]carbamate |
|---|
| CAS Number | 130369-05-0 | Molecular Weight | 201.263 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 317.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.1±19.3 °C |
|---|
Names
| Name | tert-butyl N-[3-(hydroxymethyl)cyclobutyl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 317.9±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H19NO3 |
|---|
| Molecular Weight | 201.263 |
|---|
| Flash Point | 146.1±19.3 °C |
|---|
| Exact Mass | 201.136490 |
|---|
| PSA | 62.05000 |
|---|
| LogP | 0.87 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.486 |
|---|
| InChIKey | PCPNTJQMXAHNOA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC1CC(CO)C1 |
|---|
Synonyms
| 1-Benzyl 2-tert-butyl pyrazolidine-1,2-dicarboxylate |
| pyrazolidine-1,2-dicarboxylic acid benzyl ester tert-butyl ester |
| tert-Butyl [3-(hydroxymethyl)cyclobutyl]carbamate |
| Boc-azPro benzyl ester |
| 1,1-dimethylethyl phenylmethyl 1,2-pyrazolidinedicarboxylate |
| 1,2-Pyrazolidinedicarboxylic acid,1,1-dimethylethyl phenylmethyl ester |
| 1-benzyloxycarbonyl-2-t-butoxycarbonylpyrazolidine |
| 2-Methyl-2-propanyl [3-(hydroxymethyl)cyclobutyl]carbamate |
| Carbamic acid, N-[3-(hydroxymethyl)cyclobutyl]-, 1,1-dimethylethyl ester |
| Pyrazolidine-1,2-dicarboxylic acid 1-benzyl ester 2-tert-butyl ester |