Introduction:Basic information about CAS 3976-35-0|1,3,5-trimethyl-2-phenylbenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-trimethyl-2-phenylbenzene |
|---|
| CAS Number | 3976-35-0 | Molecular Weight | 196.28800 |
|---|
| Density | 0.964g/cm3 | Boiling Point | 275ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118.7ºC |
|---|
Names
| Name | 1,3,5-trimethyl-2-phenylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.964g/cm3 |
|---|
| Boiling Point | 275ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16 |
|---|
| Molecular Weight | 196.28800 |
|---|
| Flash Point | 118.7ºC |
|---|
| Exact Mass | 196.12500 |
|---|
| LogP | 4.27880 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | CDKUYUULLQLNFF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(-c2ccccc2)c(C)c1 |
|---|
Synonyms
| 1,1'-Biphenyl,2,4,6-trimethyl |
| 2,4,6-trimethylbiphenyl |
| 2-phenylmesitylene |
| 2,4,6-Trimethyl-1,1'-biphenyl |
| Mesitylbenzene |
| 1-phenyl-2,4,6-trimethylbenzene |
| 2,4,6-trimethyldiphenyl |