Introduction:Basic information about CAS 65862-78-4|(1R,3R,5S,6R)-8-Methyl-3-[(3,4,5-trimethoxybenzoyl)oxy]-8-azabicy clo[3.2.1]oc, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,3R,5S,6R)-8-Methyl-3-[(3,4,5-trimethoxybenzoyl)oxy]-8-azabicy clo[3.2.1]oct-6-yl 1-methyl-1H-pyrrole-2-carboxylate |
|---|
| CAS Number | 65862-78-4 | Molecular Weight | 458.50400 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 546.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.3ºC |
|---|
Names
| Name | (1R,3R,5S,6R)-8-Methyl-3-[(3,4,5-trimethoxybenzoyl)oxy]-8-azabicy clo[3.2.1]oct-6-yl 1-methyl-1H-pyrrole-2-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 546.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H30N2O7 |
|---|
| Molecular Weight | 458.50400 |
|---|
| Flash Point | 284.3ºC |
|---|
| Exact Mass | 458.20500 |
|---|
| PSA | 88.46000 |
|---|
| LogP | 2.60630 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | CAHAQCHLZKGNOA-ZAWLATJESA-N |
|---|
| SMILES | COc1cc(C(=O)OC2CC3CC(OC(=O)c4cccn4C)C(C2)N3C)cc(OC)c1OC |
|---|