Introduction：Basic information about CAS 611226-24-5|2-Pyridinemethanol, 4-[4-(methylamino)-3-nitrophenoxy], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pyridinemethanol, 4-[4-(methylamino)-3-nitrophenoxy] |
|---|
| CAS Number | 611226-24-5 | Molecular Weight | 275.26000 |
|---|
| Density | 1.388g/cm3 | Boiling Point | 466.127°C at 760 mmHg |
|---|
| Molecular Formula | C13H13N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.705°C |
|---|
Names
| Name | 2-Pyridinemethanol, 4-[4-(methylamino)-3-nitrophenoxy] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.388g/cm3 |
|---|
| Boiling Point | 466.127°C at 760 mmHg |
|---|
| Molecular Formula | C13H13N3O4 |
|---|
| Molecular Weight | 275.26000 |
|---|
| Flash Point | 235.705°C |
|---|
| Exact Mass | 275.09100 |
|---|
| PSA | 100.20000 |
|---|
| LogP | 2.91230 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | FQRKHFUJNUYBPI-UHFFFAOYSA-N |
|---|
| SMILES | CNc1ccc(Oc2ccnc(CO)c2)cc1[N+](=O)[O-] |
|---|
Synonyms
| [4-(4-Methylamino-3-nitro-phenoxy)-pyridin-2-yl]-methanol |
| (3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl)boronic acid |
| [4-(4-methyl-1H-imidazol-1-yl)-3-(methyloxy)phenyl]boronic acid |
| MFCD10567179 |
| {4-[4-(Methylamino)-3-nitrophenoxy]-2-pyridinyl}methanol |
