Introduction:Basic information about CAS 132961-05-8|Risperidone Z-Oxime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Risperidone Z-Oxime |
|---|
| CAS Number | 132961-05-8 | Molecular Weight | 430.491 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 569.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H28F2N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.9±32.9 °C |
|---|
Names
| Name | 3-[2-[4-[(Z)-C-(2,4-difluorophenyl)-N-hydroxycarbonimidoyl]piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 569.0±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H28F2N4O2 |
|---|
| Molecular Weight | 430.491 |
|---|
| Flash Point | 297.9±32.9 °C |
|---|
| Exact Mass | 430.218048 |
|---|
| PSA | 70.72000 |
|---|
| LogP | 3.16 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | BRCINVRBDDVLDW-QYQHSDTDSA-N |
|---|
| SMILES | Cc1nc2n(c(=O)c1CCN1CCC(C(=NO)c3ccc(F)cc3F)CC1)CCCC2 |
|---|
| Storage condition | 2-8℃ |
|---|
Synonyms
| 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-[2-[4-[(Z)-(2,4-difluorophenyl)(hydroxyimino)methyl]-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl- |
| 3-(2-{4-[(Z)-(2,4-Difluorophenyl)(hydroxyimino)methyl]-1-piperidinyl}ethyl)-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one |
| Risperidone Z-oxime |
| 3-(2-{4-[(Z)-(2,4-Difluorophenyl)(hydroxyimino)methyl]piperidin-1-yl}ethyl)-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one |
| 2-Fluoro risperidone Z-oxime |
| UNII-2D16ZRA893 |
| Risperidone Z-Oxime |
| Risperidone Impurity 1 |