Introduction：Basic information about CAS 168135-66-8|5-(3,4-dichlorophenyl)-5-oxopentanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(3,4-dichlorophenyl)-5-oxopentanoic acid |
|---|
| CAS Number | 168135-66-8 | Molecular Weight | 261.10100 |
|---|
| Density | 1.381g/cm3 | Boiling Point | 452.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.6ºC |
|---|
Names
| Name | 5-(3,4-dichlorophenyl)-5-oxopentanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.381g/cm3 |
|---|
| Boiling Point | 452.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10Cl2O3 |
|---|
| Molecular Weight | 261.10100 |
|---|
| Flash Point | 227.6ºC |
|---|
| Exact Mass | 260.00100 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 3.43100 |
|---|
| Vapour Pressure | 5.54E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | XDNXUPLVNCSNBM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCCC(=O)c1ccc(Cl)c(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
