Introduction：Basic information about CAS 16224-36-5|4, 4'- (1-Methylethyliden)-bis (2,6-bis(dimethylaminomethyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4, 4'- (1-Methylethyliden)-bis (2,6-bis(dimethylaminomethyl)phenol |
|---|
| CAS Number | 16224-36-5 | Molecular Weight | 456.66400 |
|---|
| Density | 1.072g/cm3 | Boiling Point | 505.2ºC at 760mmHg |
|---|
| Molecular Formula | C27H44N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.9ºC |
|---|
Names
| Name | 4-[2-[3,5-bis[(dimethylamino)methyl]-4-hydroxyphenyl]propan-2-yl]-2,6-bis[(dimethylamino)methyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.072g/cm3 |
|---|
| Boiling Point | 505.2ºC at 760mmHg |
|---|
| Molecular Formula | C27H44N4O2 |
|---|
| Molecular Weight | 456.66400 |
|---|
| Flash Point | 198.9ºC |
|---|
| Exact Mass | 456.34600 |
|---|
| PSA | 53.42000 |
|---|
| LogP | 3.67010 |
|---|
| Vapour Pressure | 7.93E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | LLIYAFSMVQLZQF-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)Cc1cc(C(C)(C)c2cc(CN(C)C)c(O)c(CN(C)C)c2)cc(CN(C)C)c1O |
|---|
Synonyms
| 2.2-Bis-[4-hydroxy-3.5-bis-(dimethylamino-methyl)-phenyl]-propan |
| 2,6,2',6'-Tetrakis-dimethylaminomethyl-4,4'-isopropyliden-di-phenol |
| 2,2-Bis<4-hydroxy-3,5-bis(dimethylaminomethylphenyl)>propane |
| 2,5,2',5'-tetra(dimethylaminemethylene)-4,4'-isopropylidenediphenol |
| 4,4'-(2,2-propanediyl)bis{2,6-bis[(dimethylamino)methyl]phenol} |
| 4,4'-propane-2,2-diylbis{2,6-bis[(dimethylamino)methyl]phenol} |
| 2,6,2',6'-tetrakis-dimethylaminomethyl-4,4'-isopropylidene-di-phenol |
