Introduction：Basic information about CAS 162283-70-7|Propionylshikonin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propionylshikonin |
|---|
| CAS Number | 162283-70-7 | Molecular Weight | 344.35900 |
|---|
| Density | 1.297g/cm3 | Boiling Point | 560.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H20O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.9ºC |
|---|
Names
| Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.297g/cm3 |
|---|
| Boiling Point | 560.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H20O6 |
|---|
| Molecular Weight | 344.35900 |
|---|
| Flash Point | 200.9ºC |
|---|
| Exact Mass | 344.12600 |
|---|
| PSA | 100.90000 |
|---|
| LogP | 3.08130 |
|---|
| Vapour Pressure | 3.72E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | DLBQFLWCDFTEQG-OAHLLOKOSA-N |
|---|
| SMILES | CCC(=O)OC(CC=C(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
|---|
Synonyms
| 1,4-Naphthalenedione,5,8-dihydroxy-2-((1R)-4-methyl-1-(1-oxopropoxy)-3-pentenyl) |
| 5,8-Dihydroxy-2-((1R)-4-methyl-1-(1-oxopropoxy)-3-pentenyl)-1,4-naphthalenedione |
| Propionylshikonin |
