Introduction：Basic information about CAS 16259-34-0|penimocycline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | penimocycline |
|---|
| CAS Number | 16259-34-0 | Molecular Weight | 805.85000 |
|---|
| Density | 1.62g/cm3 | Boiling Point | 1064.8ºC at 760mmHg |
|---|
| Molecular Formula | C39H43N5O12S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 597.8ºC |
|---|
Names
| Name | 6-[[2-[[[(4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carbonyl]amino]methylamino]-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.62g/cm3 |
|---|
| Boiling Point | 1064.8ºC at 760mmHg |
|---|
| Molecular Formula | C39H43N5O12S |
|---|
| Molecular Weight | 805.85000 |
|---|
| Flash Point | 597.8ºC |
|---|
| Exact Mass | 805.26300 |
|---|
| PSA | 298.65000 |
|---|
| LogP | 2.18940 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.748 |
|---|
| InChIKey | XXYRJHQJYSUIJA-YABKDXSZSA-N |
|---|
| SMILES | CN(C)C1C(=O)C(C(=O)NCNC(C(=O)NC2C(=O)N3C2SC(C)(C)C3C(=O)O)c2ccccc2)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12 |
|---|
Synonyms
| Penimocycline |
| EINECS 240-365-5 |
| UNII-2176O1M292 |
| Penimocycline [INN:DCF] |
| Penimociclina |
| Penimocyclinum |
| Penimocyclinum [INN-Latin] |
| Penimociclina [INN-Spanish] |
