Introduction:Basic information about CAS 137941-45-8|Arillatose B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Arillatose B |
|---|
| CAS Number | 137941-45-8 | Molecular Weight | 518.465 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 843.2±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H30O14 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 287.2±27.8 °C |
|---|
Names
| Name | Arillatose B |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 843.2±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H30O14 |
|---|
| Molecular Weight | 518.465 |
|---|
| Flash Point | 287.2±27.8 °C |
|---|
| Exact Mass | 518.163574 |
|---|
| PSA | 225.06000 |
|---|
| LogP | 1.62 |
|---|
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | XMBZZLUIFFOAHR-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C=CC(=O)OCC2OC(OC3(CO)OC(CO)C(O)C3O)C(O)C(O)C2O)ccc1O |
|---|
Safety Information
Synonyms
| Arillatose B |
| β-D-Fructofuranosyl 6-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoyl]-α-D-glucopyranoside |
| α-D-Glucopyranoside, β-D-fructofuranosyl 6-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]- |