Introduction：Basic information about CAS 1309362-77-3|3-[(2R)-2-Carboxy-2-hydroxyethyl]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[(2R)-2-Carboxy-2-hydroxyethyl]benzoic acid |
|---|
| CAS Number | 1309362-77-3 | Molecular Weight | 210.183 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 475.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.4±22.4 °C |
|---|
Names
| Name | Cerberic acid B |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 475.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H10O5 |
|---|
| Molecular Weight | 210.183 |
|---|
| Flash Point | 255.4±22.4 °C |
|---|
| Exact Mass | 210.052826 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 0.73 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.619 |
|---|
| InChIKey | QOJNCZPYJHQQOQ-MRVPVSSYSA-N |
|---|
| SMILES | O=C(O)c1cccc(CC(O)C(=O)O)c1 |
|---|
Synonyms
| Benzenepropanoic acid, 3-carboxy-α-hydroxy-, (αR)- |
| 3-[(2R)-2-Carboxy-2-hydroxyethyl]benzoic acid |
