Introduction：Basic information about CAS 3634-67-1|trihexylchlorosilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trihexylchlorosilane |
|---|
| CAS Number | 3634-67-1 | Molecular Weight | 319.041 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 319.3±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H39ClSi | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 188.6±8.8 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | chloro(trihexyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 319.3±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H39ClSi |
|---|
| Molecular Weight | 319.041 |
|---|
| Flash Point | 188.6±8.8 °C |
|---|
| Exact Mass | 318.250946 |
|---|
| LogP | 10.15 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.444 |
|---|
| InChIKey | WZQSBCHNVPAYOC-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCC[Si](Cl)(CCCCCC)CCCCCC |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45-S28-S27 |
|---|
| RIDADR | 2987 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| EINECS 222-851-9 |
| Silane,chlorotrihexyl |
| trihexylsilylchloride |
| Chloro(trihexyl)silane |
| chloro-tri-n-hexylsilane |
| trihexylchlorosilane |
| tri-n-Hexylchlorosilane |
| MFCD00000510 |
| tri-n-hexylsilyl chloride |
| chloro-trihexylsilane |
| Silane, chlorotrihexyl- |
